Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Calcium Nitrate ACS AR Crystal, Macron Fine Chemicals™
CAS: 13477-34-4 Molecular Formula: CaH8N2O10 Molecular Weight (g/mol): 236.15 InChI Key: MWGCGFYACDTFSB-UHFFFAOYSA-N Synonym: calcium nitrate tetrahydrate,calcium nitrate hydrate, puratronic,acmc-1aekc,calcium nitrate tetra hydrate,ca.2no3.4h2o,ca no3 2.4h2o,calcium tetrahydrate dinitronate,calcium nitrate-water 1/4,calcium tetrahydrate dinitrate,calcium 2+ tetrahydrate dinitronate PubChem CID: 16211656 ChEBI: CHEBI:86159 IUPAC Name: calcium bis(nitric acid) tetrahydrate SMILES: O.[Ca++].[O-][N+]([O-])=O
| PubChem CID | 16211656 |
|---|---|
| CAS | 13477-34-4 |
| Molecular Weight (g/mol) | 236.15 |
| ChEBI | CHEBI:86159 |
| SMILES | O.[Ca++].[O-][N+]([O-])=O |
| Synonym | calcium nitrate tetrahydrate,calcium nitrate hydrate, puratronic,acmc-1aekc,calcium nitrate tetra hydrate,ca.2no3.4h2o,ca no3 2.4h2o,calcium tetrahydrate dinitronate,calcium nitrate-water 1/4,calcium tetrahydrate dinitrate,calcium 2+ tetrahydrate dinitronate |
| IUPAC Name | calcium bis(nitric acid) tetrahydrate |
| InChI Key | MWGCGFYACDTFSB-UHFFFAOYSA-N |
| Molecular Formula | CaH8N2O10 |
Sodium trifluoromethanesulfinate, 98%
CAS: 2926-29-6 Molecular Formula: CF3NaO2S Molecular Weight (g/mol): 156.06 InChI Key: KAVUKAXLXGRUCD-UHFFFAOYSA-M Synonym: sodium trifluoromethanesulfinate,sodium trifluoromethanesulphinate,sodium trifluoro-methanesulfinate,trifluoromethanesulfinic acid sodium salt,methanesulfinic acid, trifluoro-, sodium salt,langlois reagent,chf3o2s.na,acmc-209h7v,ksc563a2r,sodium trifluoromethylsulfinate PubChem CID: 23690734 IUPAC Name: sodium;trifluoromethanesulfinate SMILES: C(F)(F)(F)S(=O)[O-].[Na+]
| PubChem CID | 23690734 |
|---|---|
| CAS | 2926-29-6 |
| Molecular Weight (g/mol) | 156.06 |
| SMILES | C(F)(F)(F)S(=O)[O-].[Na+] |
| Synonym | sodium trifluoromethanesulfinate,sodium trifluoromethanesulphinate,sodium trifluoro-methanesulfinate,trifluoromethanesulfinic acid sodium salt,methanesulfinic acid, trifluoro-, sodium salt,langlois reagent,chf3o2s.na,acmc-209h7v,ksc563a2r,sodium trifluoromethylsulfinate |
| IUPAC Name | sodium;trifluoromethanesulfinate |
| InChI Key | KAVUKAXLXGRUCD-UHFFFAOYSA-M |
| Molecular Formula | CF3NaO2S |
Zinc titanium oxide, 99.9% (metals basis)
CAS: 12036-69-0 Molecular Formula: O4TiZn2 Molecular Weight (g/mol): 242.62 MDL Number: MFCD00054107 InChI Key: ZBFOLPMOGPIUGP-UHFFFAOYSA-N Synonym: Zinc titanate
| CAS | 12036-69-0 |
|---|---|
| Molecular Weight (g/mol) | 242.62 |
| MDL Number | MFCD00054107 |
| Synonym | Zinc titanate |
| InChI Key | ZBFOLPMOGPIUGP-UHFFFAOYSA-N |
| Molecular Formula | O4TiZn2 |
Beryllium sulfate tetrahydrate, 99.99% (metals basis), Thermo Scientific Chemicals
CAS: 7787-56-6 Molecular Formula: BeH8O8S Molecular Weight (g/mol): 177.128 MDL Number: MFCD00149156 InChI Key: DIMYTQPLZWDZFE-UHFFFAOYSA-L Synonym: beryllium sulfate tetrahydrate,ccris 85,beryllium sulphate tetrahydrate,beryllium monosulfate tetrahydrate,unii-2tyk3lf8zn,beryllium sulfate, tetrahydrate 1:1:4,2tyk3lf8zn,sulfuric acid, beryllium salt 1:1 , tetrahydrate,beryllium sulfate tetrahydrate beryllium and beryllium compounds,dsstox_cid_4603 PubChem CID: 62672 ChEBI: CHEBI:53502 IUPAC Name: beryllium;sulfate;tetrahydrate SMILES: [Be+2].O.O.O.O.[O-]S(=O)(=O)[O-]
| PubChem CID | 62672 |
|---|---|
| CAS | 7787-56-6 |
| Molecular Weight (g/mol) | 177.128 |
| ChEBI | CHEBI:53502 |
| MDL Number | MFCD00149156 |
| SMILES | [Be+2].O.O.O.O.[O-]S(=O)(=O)[O-] |
| Synonym | beryllium sulfate tetrahydrate,ccris 85,beryllium sulphate tetrahydrate,beryllium monosulfate tetrahydrate,unii-2tyk3lf8zn,beryllium sulfate, tetrahydrate 1:1:4,2tyk3lf8zn,sulfuric acid, beryllium salt 1:1 , tetrahydrate,beryllium sulfate tetrahydrate beryllium and beryllium compounds,dsstox_cid_4603 |
| IUPAC Name | beryllium;sulfate;tetrahydrate |
| InChI Key | DIMYTQPLZWDZFE-UHFFFAOYSA-L |
| Molecular Formula | BeH8O8S |
Silver wire, 0.05mm (0.002in) dia, annealed, 99.99% (metals basis)
CAS: 7440-22-4 Molecular Formula: Ag Molecular Weight (g/mol): 107.87 MDL Number: MFCD00003397 InChI Key: BQCADISMDOOEFD-UHFFFAOYSA-N Synonym: argentum,metal,atom,colloidal,silver, colloidal,silver, elemental,algaedyn,amalgum,epinall,silber PubChem CID: 23954 ChEBI: CHEBI:9141 IUPAC Name: silver SMILES: [Ag]
| PubChem CID | 23954 |
|---|---|
| CAS | 7440-22-4 |
| Molecular Weight (g/mol) | 107.87 |
| ChEBI | CHEBI:9141 |
| MDL Number | MFCD00003397 |
| SMILES | [Ag] |
| Synonym | argentum,metal,atom,colloidal,silver, colloidal,silver, elemental,algaedyn,amalgum,epinall,silber |
| IUPAC Name | silver |
| InChI Key | BQCADISMDOOEFD-UHFFFAOYSA-N |
| Molecular Formula | Ag |
Cyclopentadienylmanganese tricarbonyl
CAS: 12079-65-1 MDL Number: MFCD00001440 Synonym: Tricarbonylcyclopentadienylmanganese
| CAS | 12079-65-1 |
|---|---|
| MDL Number | MFCD00001440 |
| Synonym | Tricarbonylcyclopentadienylmanganese |
Cerium zirconium oxide, 99.5% (metals basis), Thermo Scientific Chemicals
CAS: 53169-24-7 MDL Number: MFCD00168089 Synonym: Cerium zirconate
| CAS | 53169-24-7 |
|---|---|
| MDL Number | MFCD00168089 |
| Synonym | Cerium zirconate |
Potassium tetracyanoplatinate(II) trihydrate, 99.9% (metals basis), Pt 44.9% min
CAS: 14323-36-5 Molecular Formula: C4H6K2N4O3Pt Molecular Weight (g/mol): 431.40 MDL Number: MFCD00011374 InChI Key: KBALGZKVNFJSRU-UHFFFAOYSA-N IUPAC Name: dipotassium tetracyanoplatinumbis(ylium) trihydrate SMILES: O.O.O.[K+].[K+].N#C[Pt++](C#N)(C#N)C#N
| CAS | 14323-36-5 |
|---|---|
| Molecular Weight (g/mol) | 431.40 |
| MDL Number | MFCD00011374 |
| SMILES | O.O.O.[K+].[K+].N#C[Pt++](C#N)(C#N)C#N |
| IUPAC Name | dipotassium tetracyanoplatinumbis(ylium) trihydrate |
| InChI Key | KBALGZKVNFJSRU-UHFFFAOYSA-N |
| Molecular Formula | C4H6K2N4O3Pt |
Nickel(II) Nitrate Hexahydrate, purum p.a, ≥97.0% (KT), Solstice
CAS: 13478-00-7 Molecular Formula: H12N2NiO12 Molecular Weight (g/mol): 290.79 MDL Number: MFCD00149805 InChI Key: AOPCKOPZYFFEDA-UHFFFAOYSA-N Synonym: nickel nitrate hexahydrate,nickel ii nitrate hexahydrate,nickel dinitrate hexahydrate,nickel 2+ dinitrate hexahydrate,unii-xbt61wlt1j,nickelous nitrate hexahydrate,nickel 2+ nitrate, hexahydrate,xbt61wlt1j,nitric acid, nickel 2+ salt, hexahydrate,nickel ii nitrate, hexahydrate 1:2:6 PubChem CID: 61630 SMILES: O.O.O.O.O.O.[Ni++].[O-][N+]([O-])=O.[O-][N+]([O-])=O
| PubChem CID | 61630 |
|---|---|
| CAS | 13478-00-7 |
| Molecular Weight (g/mol) | 290.79 |
| MDL Number | MFCD00149805 |
| SMILES | O.O.O.O.O.O.[Ni++].[O-][N+]([O-])=O.[O-][N+]([O-])=O |
| Synonym | nickel nitrate hexahydrate,nickel ii nitrate hexahydrate,nickel dinitrate hexahydrate,nickel 2+ dinitrate hexahydrate,unii-xbt61wlt1j,nickelous nitrate hexahydrate,nickel 2+ nitrate, hexahydrate,xbt61wlt1j,nitric acid, nickel 2+ salt, hexahydrate,nickel ii nitrate, hexahydrate 1:2:6 |
| InChI Key | AOPCKOPZYFFEDA-UHFFFAOYSA-N |
| Molecular Formula | H12N2NiO12 |
Hafnium telluride, 99.5% (metals basis)
CAS: 39082-23-0 Molecular Formula: HfTe2 Molecular Weight (g/mol): 433.69 MDL Number: MFCD00049947 InChI Key: BCMXGUYIVFZMCT-UHFFFAOYSA-N Synonym: hafnium telluride,ditellanylidenehafnium PubChem CID: 90471877 IUPAC Name: bis(tellanylidene)hafnium SMILES: [Te]=[Hf]=[Te]
| PubChem CID | 90471877 |
|---|---|
| CAS | 39082-23-0 |
| Molecular Weight (g/mol) | 433.69 |
| MDL Number | MFCD00049947 |
| SMILES | [Te]=[Hf]=[Te] |
| Synonym | hafnium telluride,ditellanylidenehafnium |
| IUPAC Name | bis(tellanylidene)hafnium |
| InChI Key | BCMXGUYIVFZMCT-UHFFFAOYSA-N |
| Molecular Formula | HfTe2 |
Magnesium tetraborate, 99%
CAS: 12007-62-4 Molecular Formula: B2Mg3O6 Molecular Weight (g/mol): 190.529 MDL Number: MFCD02688001 InChI Key: NFMWFGXCDDYTEG-UHFFFAOYSA-N Synonym: acmc-1bvay,boric acid h3bo3 , magnesium salt 2:3,ksc171o6l,trimagnesium 2+ diborate,parent,trimagnesium 2+ ion diborate PubChem CID: 21981398 IUPAC Name: trimagnesium;diborate SMILES: B([O-])([O-])[O-].B([O-])([O-])[O-].[Mg+2].[Mg+2].[Mg+2]
| PubChem CID | 21981398 |
|---|---|
| CAS | 12007-62-4 |
| Molecular Weight (g/mol) | 190.529 |
| MDL Number | MFCD02688001 |
| SMILES | B([O-])([O-])[O-].B([O-])([O-])[O-].[Mg+2].[Mg+2].[Mg+2] |
| Synonym | acmc-1bvay,boric acid h3bo3 , magnesium salt 2:3,ksc171o6l,trimagnesium 2+ diborate,parent,trimagnesium 2+ ion diborate |
| IUPAC Name | trimagnesium;diborate |
| InChI Key | NFMWFGXCDDYTEG-UHFFFAOYSA-N |
| Molecular Formula | B2Mg3O6 |
Tin(II) Chloride Dihydrate, For Analysis, EMSURE™Test Kit, For water determination, According to Karl Fischer, Apura™, MilliporeSigma™
CAS: 10025-69-1 Molecular Formula: SnCl2·2H2O Synonym: Tin Dichloride
| CAS | 10025-69-1 |
|---|---|
| Synonym | Tin Dichloride |
| Molecular Formula | SnCl2·2H2O |
Copper plate, irregular, nominal 10x34x0.6cm (4x13.5x0.25in), Puratronic™, 99.999% (metals basis)
CAS: 7440-50-8 Molecular Formula: Cu Molecular Weight (g/mol): 63.55 MDL Number: MFCD00010965 InChI Key: RYGMFSIKBFXOCR-UHFFFAOYSA-N Synonym: cuprum,cobre,cuivre,blister,cathode,bronze,powder,anode,precipitates,kupfer PubChem CID: 23978 ChEBI: CHEBI:30052 IUPAC Name: copper SMILES: [Cu]
| PubChem CID | 23978 |
|---|---|
| CAS | 7440-50-8 |
| Molecular Weight (g/mol) | 63.55 |
| ChEBI | CHEBI:30052 |
| MDL Number | MFCD00010965 |
| SMILES | [Cu] |
| Synonym | cuprum,cobre,cuivre,blister,cathode,bronze,powder,anode,precipitates,kupfer |
| IUPAC Name | copper |
| InChI Key | RYGMFSIKBFXOCR-UHFFFAOYSA-N |
| Molecular Formula | Cu |
Cobalt wire, 1.5mm (0.06in) dia, 99.95% (metals basis)
CAS: 7440-48-4 Molecular Formula: Co Molecular Weight (g/mol): 58.93 MDL Number: MFCD00010935 InChI Key: GUTLYIVDDKVIGB-UHFFFAOYSA-N Synonym: kobalt,cobalto,moncation,co1+,cobaltum,powder,cobalt, ion co1+,hydrido,atom,hydride PubChem CID: 104730 ChEBI: CHEBI:27638 IUPAC Name: cobalt SMILES: [Co]
| PubChem CID | 104730 |
|---|---|
| CAS | 7440-48-4 |
| Molecular Weight (g/mol) | 58.93 |
| ChEBI | CHEBI:27638 |
| MDL Number | MFCD00010935 |
| SMILES | [Co] |
| Synonym | kobalt,cobalto,moncation,co1+,cobaltum,powder,cobalt, ion co1+,hydrido,atom,hydride |
| IUPAC Name | cobalt |
| InChI Key | GUTLYIVDDKVIGB-UHFFFAOYSA-N |
| Molecular Formula | Co |
Lithium (trimethylsilyl)acetylide, 0.5M solution in THF, AcroSeal™, Thermo Scientific Chemicals
CAS: 54655-07-1 Molecular Formula: C5H9LiSi Molecular Weight (g/mol): 104.15 MDL Number: MFCD00075059 InChI Key: WDDOQHLJFOUQMW-UHFFFAOYSA-N Synonym: trimethylsilyl ethynyllithium,lithium, trimethylsilyl ethynyl,lithium 1+ ion trimethylsilyl ethyne,lithium trimethylsilylacetylide,lithio trimethylsilyl acetylene,lithium trimethylsilyl acetylide,lithium ethynyl trimethyl silane,lithium trimethylsilylacetylenide,zvxxeonxfwsciz-uhfffaoysa-n PubChem CID: 3431600 IUPAC Name: lithium;ethynyl(trimethyl)silane SMILES: [Li+].C[Si](C)(C)C#[C-]
| PubChem CID | 3431600 |
|---|---|
| CAS | 54655-07-1 |
| Molecular Weight (g/mol) | 104.15 |
| MDL Number | MFCD00075059 |
| SMILES | [Li+].C[Si](C)(C)C#[C-] |
| Synonym | trimethylsilyl ethynyllithium,lithium, trimethylsilyl ethynyl,lithium 1+ ion trimethylsilyl ethyne,lithium trimethylsilylacetylide,lithio trimethylsilyl acetylene,lithium trimethylsilyl acetylide,lithium ethynyl trimethyl silane,lithium trimethylsilylacetylenide,zvxxeonxfwsciz-uhfffaoysa-n |
| IUPAC Name | lithium;ethynyl(trimethyl)silane |
| InChI Key | WDDOQHLJFOUQMW-UHFFFAOYSA-N |
| Molecular Formula | C5H9LiSi |